Théaflavine
composé chimique
Les théaflavines sont, avec les théarubigines, les polyphénols principaux du thé noir.
| Théaflavine | |
| |
| Structure chimique | |
| Identification | |
|---|---|
| Nom UICPA | 3,4,5-trihydroxy-1,8-bis[(2R,3R)-3,5,7-trihydroxy-2-chromanyl]-6-benzo[7]annulénone |
| No CAS | |
| SMILES | c12c([C@H]3Oc4cc(O)cc(O)c4C[C@H]3O)cc(c(c1c(c(cc(c2)[C@H]1Oc2c(C[C@H]1O)c(cc(c2)O)O)O)=O)O)O , |
| InChI | InChI : InChI=1/C29H24O12/c30-11-3-17(32)15-8-21(36)28(40-23(15)5-11)10-1-13-14(7-20(35)27(39)25(13)26(38)19(34)2-10)29-22(37)9-16-18(33)4-12(31)6-24(16)41-29/h1-7,21-22,28-33,35-37,39H,8-9H2,(H,34,38)/t21-,22-,28-,29-/m1/s1 |
| Propriétés chimiques | |
| Formule | C29H24O12 [Isomères] |
| Masse molaire[1] | 564,493 7 ± 0,028 5 g/mol C 61,7 %, H 4,29 %, O 34,01 %, |
| Écotoxicologie | |
| DL50 | 562 mg·kg-1 (souris, i.p.) [2] |
| Unités du SI et CNTP, sauf indication contraire. | |
modifier  |
|
Notes et références
modifier- ↑ Masse molaire calculée d’après « Atomic weights of the elements 2007 », sur www.chem.qmul.ac.uk.
- ↑ (en) « Theaflavin », sur ChemIDplus ( chem.nlm.nih.gov ), consulté le 7 février 2009
