Quaterthiophène
composé chimique
Le quaterthiophène est un composé organique, oligomère du thiophène. Il fait partie des semi-conducteurs organiques.
| Quaterthiophène | |
| Identification | |
|---|---|
| Nom UICPA | 2-thiophèn-2-yl-5-(5-thiophèn-2-ylthiophèn-2-yl)thiophène 2,2':5',2'':5'',2'''-quaterthiophène |
| Synonymes |
α-quaterthiényl |
| No CAS | |
| PubChem | 395493 |
| SMILES | C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=CS4 , |
| InChI | InChI : InChI=1S/C16H10S4/c1-3-11(17-9-1)13-5-7-15(19-13)16-8-6-14(20-16)12-4-2-10-18-12/h1-10H InChIKey : FXEJOIFDICYSSO-UHFFFAOYSA-N |
| Propriétés chimiques | |
| Formule | C16H10S4 [Isomères] |
| Masse molaire[1] | 330,511 ± 0,034 g/mol C 58,14 %, H 3,05 %, S 38,81 %, |
| Propriétés physiques | |
| T° fusion | 216 °C |
| Unités du SI et CNTP, sauf indication contraire. | |
modifier  |
|
Notes et références
modifier- ↑ Masse molaire calculée d’après « Atomic weights of the elements 2007 », sur www.chem.qmul.ac.uk.
